A | B | C | D | E | F | G | H | CH | I | J | K | L | M | N | O | P | Q | R | S | T | U | V | W | X | Y | Z | 0 | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9
Standard header for logs from CheMoBot
- 01:43:38 (0, 0, 2) (EDIT) User:142.167.78.84 (contribs, talk) edited Metformin (diff, hist)
Added links: http://www.annals.org/cgi/reprint/137/1/25.pdf - 06:15:27 (0, 0, 2) (EDIT) User:Danicc (contribs, talk) edited Physostigmine (diff, hist)
Added links: http://books.google.com/books?id=q2ku1dbnaLYC&pg=PA53&dq=the+antidote+for+belladonna+is+physostigmine+or+pilocarpine+the+same+as+for+atropine&ei=F5PAR6a0KofCtAPa_ty2CA 13:39:18 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Dextrorphan (diff, hist)
Changed: 'ATC_prefix' ('none' -> '')- 13:45:47 (0, 0, 2) (EDIT) User:79.1.113.36 (contribs, talk) edited Melatonin (diff, hist)
Added links: http://www.youtube.com/watch?v=CtVIF_IbvkM - 14:03:18 (0, 0, 2) (EDIT) User:Goddess133 (contribs, talk) edited Methadone (diff, hist)
Added links: http://pharmaceuticals.mallinckrodt.com/AddictionTreatment/ - 14:25:59 (0, 0, 2) (EDIT) User:Knowledgejwl (contribs, talk) edited Mapatumumab (diff, hist)
Added links: http://www.hgsi.com/technology-collaborations.html, http://www.nature.com/bjc/journal/v92/n8/abs/6602487a.html, http://www.hgsi.com/latest/human-genome-sciences-reports-results-of-phase-1-clinical-trials-of-hgs-etr1-trail-r1-mab-in-patients-with-advanced-ca.html, http://www.hgsi.com/latest/human-genome-sciences-reports-results-of-ongoing-phase-1-clinical-trials-of-hgs-etr1-in-patients-with-advanced-ca.html, http://www.hgsi.com/latest/human-genome-sciences-initiates-a-phase-2-clinical-trial-of-hgs-etr1-in-patients-with-colorectal-c.html, http://www.hgsi.com/latest/human-genome-sciences-begins-dosing-of-patients-in-a-phase-2-clinical-trial-of-hgs-etr1-in-non-hodgkina-s-lym.html, http://www.hgsi.com/latest/human-genome-sciences-completes-patient-enrollment-in-a-phase-2-clinical-trial-of-hgs-etr1-for-the-treatment-of-non-small-cell-lung-c-2.html, http://www.hgsi.com/latest/human-genome-sciences-completes-patient-enrollment-in-a-phase-2-clinical-trial-of-hgs-etr1-for-the-treatment-of-colorectal-c.html, http://www. - 16:15:56 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'error' ('' -> 'empty') - 16:15:56 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'boxname' ('drugbox' -> '') - 16:15:57 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'image' ('Tametraline.png' -> '') - 16:15:57 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'pregnancy_AU' ('<!-- A / B1 / B2 / B3 / C / D / X -->' -> '') - 16:15:57 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'pregnancy_US' ('<!-- A / B / C / D / X -->' -> '') - 16:15:57 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'legal_AU' ('<!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->' -> '') - 16:15:58 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'legal_CA' ('<!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->' -> '') - 16:15:58 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'legal_UK' ('<!-- GSL / P / POM / CD / Class A, B, C -->' -> '') - 16:15:58 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'legal_US' ('<!-- OTC / Rx-only / Schedule I, II, III, IV, V -->' -> '') - 16:15:58 (1, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'legal_status' ('Legal' -> '') - 16:15:59 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'IUPAC_name' ('(1R,4S)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine' -> '') - 16:15:59 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'molecular_weight' ('237.339 g/mol' -> '') - 16:15:59 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'smiles' ('c3cccc1c3C(CCC1NC)c2ccccc2' -> '') - 16:16:00 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'C' ('17' -> '') - 16:16:00 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'H' ('19' -> '') - 16:16:00 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'N' ('1' -> '') - 16:16:00 (2, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'PubChem' ('104180' -> '') - 16:16:01 (3, 1, 3) (EDIT) User:Nuklear (contribs, talk) edited Tametraline (diff, hist)
Changed: 'CAS_number' ('52760-47-1' -> '') - 16:34:33 (0, 0, 2) (EDIT) User:Hordaland (contribs, talk) edited Melatonin (diff, hist)
Added links: http://www.nlm.nih.gov/medlineplus/druginfo/natural/patient-melatonin.html - 18:23:39 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'error' ('' -> 'empty') - 18:23:39 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'boxname' ('drugbox' -> '') - 18:23:39 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image' ('MDMA.svg' -> '') - 18:23:40 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image2' ('MDMA_animation.gif' -> '') - 18:23:40 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChemSpiderID' ('1556' -> '') - 18:23:40 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'synonyms' ('1,3-benzodioxolyl-''N''-methyl-2-propanamine;<br/>3,4-methylenedioxy-''N''-methyl-α-methyl-2-phenethylamine;<br/>3,4-methylenedioxy-''N''-methylamphetamine;<br/>methylenedioxymethamphetamine' -> '') - 18:23:40 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('The half-life of MDMA is dose-dependent, increasing with higher doses, but is around 6â10 hours at doses of 40â125 mg; though, its duration is typically much shorter, typically around 3-6 hours in contrast' -> '') - 18:23:41 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'metabolism' ('Liver|Hepatic, Cytochrome P450 oxidase|CYP450 extensively involved, especially CYP2D6' -> '') - 18:23:41 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'excretion' ('Kidney|Renal' -> '') - 18:23:41 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_AU' ('S9' -> '') - 18:23:42 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_US' ('Schedule I' -> '') - 18:23:43 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_UK' ('Class A' -> '') - 18:23:43 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_CA' ('Schedule III' -> '') - 18:23:43 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'routes_of_administration' ('Oral, sublingual, insufflation (medicine)|insufflation, inhalation (smoking), injection<ref>{{cite web | title= Methylenedioxymethamphetamine (MDMA, Ecstasy) | url = http://www.nhtsa.dot.gov/people/injury/research/job185drugs/methylenedioxymethamphetamine.htm | work = Drugs and Human Performance Fact Sheets. | publisher = National Highway Traffic Safety Administration }}</ref>' -> '') - 18:23:44 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'IUPAC_name' ('1-(benzo''d''1,3dioxol-5-yl)-''N''-methylpropan-2-amine' -> '') - 18:23:44 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'molecular_weight' ('193.25 g/mol' -> '') - 18:23:44 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'smiles' ('CC(NC)CC1=CC=C(OCO2)C2=C1' -> '') - 18:23:44 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'C' ('11' -> '') - 18:23:45 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'H' ('15' -> '') - 18:23:45 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'N' ('1' -> '') - 18:23:45 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'O' ('2' -> '') - 18:23:46 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'PubChem' ('1615' -> '') - 18:23:46 (3, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('69610-10-2' -> '') - 18:24:13 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'error' ('' -> 'empty') - 18:24:13 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'boxname' ('drugbox' -> '') - 18:24:13 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image' ('MDMA.svg' -> '') - 18:24:14 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'image2' ('MDMA_animation.gif' -> '') - 18:24:14 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'ChemSpiderID' ('1556' -> '') - 18:24:14 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'synonyms' ('1,3-benzodioxolyl-''N''-methyl-2-propanamine;<br/>3,4-methylenedioxy-''N''-methyl-α-methyl-2-phenethylamine;<br/>3,4-methylenedioxy-''N''-methylamphetamine;<br/>methylenedioxymethamphetamine' -> '') - 18:24:14 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'elimination_half-life' ('The half-life of MDMA is dose-dependent, increasing with higher doses, but is around 6â10 hours at doses of 40â125 mg; though, its duration is typically much shorter, typically around 3-6 hours in contrast' -> '') - 18:24:15 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'metabolism' ('Liver|Hepatic, Cytochrome P450 oxidase|CYP450 extensively involved, especially CYP2D6' -> '') - 18:24:15 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'excretion' ('Kidney|Renal' -> '') - 18:24:15 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_AU' ('S9' -> '') - 18:24:16 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_US' ('Schedule I' -> '') - 18:24:16 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_UK' ('Class A' -> '') - 18:24:16 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'legal_CA' ('Schedule III' -> '') - 18:24:16 (1, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'routes_of_administration' ('Oral, sublingual, insufflation (medicine)|insufflation, inhalation (smoking), injection<ref>{{cite web | title= Methylenedioxymethamphetamine (MDMA, Ecstasy) | url = http://www.nhtsa.dot.gov/people/injury/research/job185drugs/methylenedioxymethamphetamine.htm | work = Drugs and Human Performance Fact Sheets. | publisher = National Highway Traffic Safety Administration }}</ref>' -> '') - 18:24:17 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'IUPAC_name' ('1-(benzo''d''1,3dioxol-5-yl)-''N''-methylpropan-2-amine' -> '') - 18:24:17 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'molecular_weight' ('193.25 g/mol' -> '') - 18:24:18 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'smiles' ('CC(NC)CC1=CC=C(OCO2)C2=C1' -> '') - 18:24:18 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'C' ('11' -> '') - 18:24:19 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'H' ('15' -> '') - 18:24:19 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'N' ('1' -> '') - 18:24:19 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'O' ('2' -> '') - 18:24:19 (2, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'PubChem' ('1615' -> '') - 18:24:20 (3, 1, 3) (EDIT) User:Austinnn420 (contribs, talk) edited MDMA (diff, hist)
Changed: 'CAS_number' ('69610-10-2' -> '') 18:24:21 (0, 0, 2) (EDIT) User:VoABot II (contribs, talk) edited MDMA (diff, hist)
Added links: http://www.nhtsa.dot.gov/people/injury/research/job185drugs/methylenedioxymethamphetamine.htm, http://findarticles.com/p/articles/mi_m0CYD/is_11_38/ai_102839980, http://ecstasy.org/qanda/q5.html, http://www.info-drug-rehab.com/ecstasy.html, http://www.maps.org/research/, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=6707, http://v3.espacenet.com/publicationDetails/originalDocument?CC=DE&NR=274350C&FT=D, http://v3.espacenet.com/publicationDetails/originalDocument?CC=DE&NR=279194C&FT=D, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=639, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=1149, http://www.erowid.org/references/refs_view.php?ID=961&C=MDMA, http://www.nytimes.com/2005/01/30/magazine/30ECSTASY.html, http://www.maps.org/books/scr/, http://www.maps.org/res18:24:50 (0, 0, 2) (EDIT) User:VoABot II (contribs, talk) edited MDMA (diff, hist)
Added links: http://www.nhtsa.dot.gov/people/injury/research/job185drugs/methylenedioxymethamphetamine.htm, http://findarticles.com/p/articles/mi_m0CYD/is_11_38/ai_102839980, http://ecstasy.org/qanda/q5.html, http://www.info-drug-rehab.com/ecstasy.html, http://www.maps.org/research/, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://mdma.net/ecstasy-mdma.html, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=6707, http://v3.espacenet.com/publicationDetails/originalDocument?CC=DE&NR=274350C&FT=D, http://v3.espacenet.com/publicationDetails/originalDocument?CC=DE&NR=279194C&FT=D, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=639, http://www.erowid.org/references/refs_view.php?A=ShowDoc1&ID=1149, http://www.erowid.org/references/refs_view.php?ID=961&C=MDMA, http://www.nytimes.com/2005/01/30/magazine/30ECSTASY.html, http://www.maps.org/books/scr/, http://www.maps.org/res- 19:07:19 (2, 1, 2) (EDIT) User:Lchiarav (contribs, talk) edited Zidovudine (diff, hist)
Changed: 'IUPAC_name' ('1-(2''R'',4''S'',5''S'')-4-azido-5-(hydroxymethyl)oxolan-2-yl-5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione' -> '1-(2''R'',4''S'',5''S'')-3-azido-5-(hydroxymethyl)oxolan-2-yl-5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione') 20:54:03 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Gamma-Hydroxyvaleric_acid (diff, hist)
Changed: 'IUPAC_name' ('4-Hydroxyvaleric acid.svg' -> '4-hydroxyvaleric acid')- 21:22:57 (2, 2, 3) (EDIT) User:Jü (contribs, talk) edited Mesuximide (diff, hist)
Changed: 'IUPAC_name' ('1,3-dimethyl-3-phenyl-pyrrolidine-2,5-dione' -> '(''RS'')-1,3-dimethyl-3-phenyl-pyrrolidine-2,5-dione', SET '1,3-dimethyl-3-phenyl-pyrrolidine-2,5-dione') - 21:29:59 (2, 2, 3) (EDIT) User:Jü (contribs, talk) edited Ethosuximide (diff, hist)
Changed: 'IUPAC_name' ('3-ethyl-3-methyl-pyrrolidine-2,5-dione' -> '(''RS'')-3-ethyl-3-methyl-pyrrolidine-2,5-dione', SET '3-ethyl-3-methyl-pyrrolidine-2,5-dione') - 21:44:55 (2, 1, 2) (EDIT) User:Jü (contribs, talk) edited Formoterol (diff, hist)
Changed: 'IUPAC_name' ('''N''-2-hydroxy-5-1-hydroxy-2-1-(4-methoxyphenyl) propan-2-ylaminoethyl phenylformamide' -> '(''RS'',''SR'')-''N''-2-hydroxy-5-1-hydroxy-2-1-(4-methoxyphenyl) propan-2-ylaminoethyl phenylformamide') 21:48:02 (3, 1, 1) (EDIT) User:Meodipt (contribs, talk) edited Gamma-Hydroxyvaleric_acid (diff, hist)
Changed: 'CAS_number' ('' -> '13532-37-1')- 21:48:52 (2, 1, 2) (EDIT) User:Jü (contribs, talk) edited Mebeverine (diff, hist)
Changed: 'IUPAC_name' ('4-(ethyl1-(4-methoxyphenyl)propan-2-ylamino)butyl 3,4-dimethoxybenzoate' -> '(RS)-4-(ethyl1-(4-methoxyphenyl)propan-2-ylamino)butyl 3,4-dimethoxybenzoate') - 21:49:29 (2, 1, 2) (EDIT) User:Jü (contribs, talk) edited Mebeverine (diff, hist)
Changed: 'IUPAC_name' ('(RS)-4-(ethyl1-(4-methoxyphenyl)propan-2-ylamino)butyl 3,4-dimethoxybenzoate' -> '(''RS'')-4-(ethyl1-(4-methoxyphenyl)propan-2-ylamino)butyl 3,4-dimethoxybenzoate') - 21:51:14 (2, 1, 2) (EDIT) User:Jü (contribs, talk) edited Esmolol (diff, hist)
Changed: 'IUPAC_name' ('methyl 3-{4-2-hydroxy-3-(propan-2-ylamino)propoxyphenyl}propanoate' -> 'methyl (''RS'')-3-{4-2-hydroxy-3-(propan-2-ylamino)propoxyphenyl}propanoate') - 22:11:29 (0, 0, 2) (EDIT) User:SteveChervitzTrutane (contribs, talk) edited Propofol (diff, hist)
Added links: http://www.nytimes.com/2009/08/07/us/07propofol.html 22:14:19 (2, 2, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Tranylcypromine (diff, hist)
Changed: 'IUPAC_name' ('(1''R'',2''S'')-2-phenylcyclopropanamine' -> '(1''R'',2''S'')-2-phenylcyclopropylamine', SET '(1''R'',2''S'')-2-phenylcyclopropanamine')- 22:19:35 (0, 0, 2) (EDIT) User:Mcpazzo (contribs, talk) edited Atorvastatin (diff, hist)
Added links: http://media.pfizer.com/files/annualreport/2008/annual/review2008.pdf, http://www.nj.com/business/index.ssf/2009/01/pfizer_wins_patent_extension_o.html, http://media.pfizer.com/files/annualreport/2008/annual/review2008.pdf 22:34:25 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'IUPAC_name' ('2-methyl-1,2,3,4,5a,9a,10,14b-octahydrobenzo''c''pyrazino1,2-''a''pyrido3,2-''f''azepine' -> '<small>1,2,3,4,10,14b-hexahydro-2-methylpyrazino2,1-apyrido2,3-c2benzazepine</small>')22:37:18 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'molecular_weight' ('265.36' -> '265.36 g/mol')22:39:07 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'molecular_weight' ('265.36 g/mol' -> '265.35 g/mol')22:42:50 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'IUPAC_name' ('<small>1,2,3,4,10,14b-hexahydro-2-methylpyrazino2,1-apyrido2,3-c2benzazepine</small>' -> '<small>1,2,3,4,10,14b-hexahydro-2-11Cmethylpyrazino(2,1-a)pyrido(2,3-c)(2)benzazepine</small>')22:46:01 (2, 1, 1) (EDIT) User:Rocknroll714 (contribs, talk) edited Mirtazapine (diff, hist)
Changed: 'smiles' ('' -> 'CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4')23:28:28 (2, 2, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Tranylcypromine (diff, hist)
Changed: 'IUPAC_name' ('(1''R'',2''S'')-2-phenylcyclopropylamine' -> '<small>(1''R'',2''S'')-2-phenylcyclopropylamine</small>', SET '(1''R'',2''S'')-2-phenylcyclopropanamine')23:30:17 (2, 2, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Tranylcypromine (diff, hist)
Changed: 'IUPAC_name' ('<small>(1''R'',2''S'')-2-phenylcyclopropylamine</small>' -> '<small>-2-''trans''-phenylcyclopropylamine</small>', SET '(1''R'',2''S'')-2-phenylcyclopropanamine')23:30:34 (2, 2, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Tranylcypromine (diff, hist)
Changed: 'IUPAC_name' ('<small>-2-''trans''-phenylcyclopropylamine</small>' -> '<small>2-''trans''-phenylcyclopropylamine</small>', SET '(1''R'',2''S'')-2-phenylcyclopropanamine')23:33:45 (2, 2, 2) (EDIT) User:Rocknroll714 (contribs, talk) edited Tranylcypromine (diff, hist)
Changed: 'IUPAC_name' ('<small>2-''trans''-phenylcyclopropylamine</small>' -> '''trans''-2-phenylcyclopropyl-1-amine', SET '(1''R'',2''S'')-2-phenylcyclopropanamine')
Text je dostupný za podmienok Creative Commons Attribution/Share-Alike License 3.0 Unported; prípadne za ďalších podmienok. Podrobnejšie informácie nájdete na stránke Podmienky použitia.
Antropológia
Aplikované vedy
Bibliometria
Dejiny vedy
Encyklopédie
Filozofia vedy
Forenzné vedy
Humanitné vedy
Knižničná veda
Kryogenika
Kryptológia
Kulturológia
Literárna veda
Medzidisciplinárne oblasti
Metódy kvantitatívnej analýzy
Metavedy
Metodika
Text je dostupný za podmienok Creative
Commons Attribution/Share-Alike License 3.0 Unported; prípadne za ďalších
podmienok.
Podrobnejšie informácie nájdete na stránke Podmienky
použitia.
www.astronomia.sk | www.biologia.sk | www.botanika.sk | www.dejiny.sk | www.economy.sk | www.elektrotechnika.sk | www.estetika.sk | www.farmakologia.sk | www.filozofia.sk | Fyzika | www.futurologia.sk | www.genetika.sk | www.chemia.sk | www.lingvistika.sk | www.politologia.sk | www.psychologia.sk | www.sexuologia.sk | www.sociologia.sk | www.veda.sk I www.zoologia.sk